2,3,3-trimethyl-3H-indole-5-sulfonic acid (CCT-1529)

Specifications

Unit Size1 g, 5 g, 25 g
CAS132557-72-3
MDLMFCD09033907
IUPAC Name2,3,3-trimethyl-3h-indole-5-sulfonic acid
SmilesO=S(C1=CC2=C(C=C1)N=C(C)C2(C)C)(O)=O
Molecular formulaC11H13NO3S
Molecular weight239.3
Purity>95% (HPLC)
Shipping ConditionsAmbient temperature

How do I Request a Quote?

To request a quote for products:

  1. Click “Contact Us” in the header bar above;
  2. Click “Customer Service”;
  3. Complete the form and provide the following information in the “Comments” section: note you would like a quote, item number (SKU) and quantity;
  4. Click “Submit”.